C16H18N2O — CID 65447083
3-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]pyridin-4-amine (PubChem CID 65447083) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]pyridin-4-amine.
| Compound Name | 3-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]pyridin-4-amine |
|---|---|
| PubChem CID | 65447083 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]pyridin-4-amine |
| SMILES | Nc1ccncc1CCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H18N2O/c17-15-6-8-18-11-14(15)3-1-2-12-4-5-16-13(10-12)7-9-19-16/h4-6,8,10-11H,1-3,7,9H2,(H2,17,18) |
| InChIKey | HEFKBXBQASFEDH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |