C9H8ClNO3S — CID 65450610
1-[(5-chlorothiophene-2-carbonyl)amino]cyclopropane-1-carboxylic acid (PubChem CID 65450610) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 1-[(5-chlorothiophene-2-carbonyl)amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophene-2-carbonyl)amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 65450610 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 1-[(5-chlorothiophene-2-carbonyl)amino]cyclopropane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H8ClNO3S/c10-6-2-1-5(15-6)7(12)11-9(3-4-9)8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14) |
| InChIKey | WOOQOSZKOUUINM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |