C20H22Cl2N4O3S — CID 3312919
N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(5-chlorothiophene-2-carbonyl)amino]piperidine-4-carboxamide (PubChem CID 3312919) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(5-chlorothiophene-2-carbonyl)amino]piperidine-4-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(5-chlorothiophene-2-carbonyl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3312919 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(5-chlorothiophene-2-carbonyl)amino]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1(NC(=O)c2ccc(Cl)s2)CCNCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c21-14-3-1-13(2-4-14)17(27)24-11-12-25-19(29)20(7-9-23-10-8-20)26-18(28)15-5-6-16(22)30-15/h1-6,23H,7-12H2,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | GUXUDRSGZCDAAM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|