C22H27ClN4O4 — CID 3574681
N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(4,5-dimethylfuran-2-carbonyl)amino]piperidine-4-carboxamide (PubChem CID 3574681) has the molecular formula C22H27ClN4O4 and a molecular weight of 446.94 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(4,5-dimethylfuran-2-carbonyl)amino]piperidine-4-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(4,5-dimethylfuran-2-carbonyl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3574681 |
| Molecular Formula | C22H27ClN4O4 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[(4,5-dimethylfuran-2-carbonyl)amino]piperidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2(C(=O)NCCNC(=O)c3ccc(Cl)cc3)CCNCC2)oc1C |
| InChI | InChI=1S/C22H27ClN4O4/c1-14-13-18(31-15(14)2)20(29)27-22(7-9-24-10-8-22)21(30)26-12-11-25-19(28)16-3-5-17(23)6-4-16/h3-6,13,24H,7-12H2,1-2H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | BDMRVQILTRUBCU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|