C22H25Cl2N5O4 — CID 74224446
2-chloro-N-[4-[2-[(4-chlorobenzoyl)amino]ethylcarbamoyl]piperidin-4-yl]-6-methoxypyridine-4-carboxamide (PubChem CID 74224446) has the molecular formula C22H25Cl2N5O4 and a molecular weight of 494.38 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-[(4-chlorobenzoyl)amino]ethylcarbamoyl]piperidin-4-yl]-6-methoxypyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[2-[(4-chlorobenzoyl)amino]ethylcarbamoyl]piperidin-4-yl]-6-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 74224446 |
| Molecular Formula | C22H25Cl2N5O4 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-chloro-N-[4-[2-[(4-chlorobenzoyl)amino]ethylcarbamoyl]piperidin-4-yl]-6-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)NC2(C(=O)NCCNC(=O)c3ccc(Cl)cc3)CCNCC2)cc(Cl)n1 |
| InChI | InChI=1S/C22H25Cl2N5O4/c1-33-18-13-15(12-17(24)28-18)20(31)29-22(6-8-25-9-7-22)21(32)27-11-10-26-19(30)14-2-4-16(23)5-3-14/h2-5,12-13,25H,6-11H2,1H3,(H,26,30)(H,27,32)(H,29,31) |
| InChIKey | PDWFBZJRZUHSSW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|