C25H29ClN4O3S — CID 74226084
N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[(E)-2-phenylethenyl]sulfanylacetyl]amino]piperidine-4-carboxamide (PubChem CID 74226084) has the molecular formula C25H29ClN4O3S and a molecular weight of 501.05 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[(E)-2-phenylethenyl]sulfanylacetyl]amino]piperidine-4-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[(E)-2-phenylethenyl]sulfanylacetyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74226084 |
| Molecular Formula | C25H29ClN4O3S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-4-[[2-[(E)-2-phenylethenyl]sulfanylacetyl]amino]piperidine-4-carboxamide |
| SMILES | O=C(CS/C=C/c1ccccc1)NC1(C(=O)NCCNC(=O)c2ccc(Cl)cc2)CCNCC1 |
| InChI | InChI=1S/C25H29ClN4O3S/c26-21-8-6-20(7-9-21)23(32)28-15-16-29-24(33)25(11-13-27-14-12-25)30-22(31)18-34-17-10-19-4-2-1-3-5-19/h1-10,17,27H,11-16,18H2,(H,28,32)(H,29,33)(H,30,31)/b17-10+ |
| InChIKey | AZDBARBLWLGGME-LICLKQGHSA-N |
| XLogP | 2.83 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|