C20H23ClN4O4S2 — CID 11752034
5-chloro-N-[2-[[4-[(Z)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 11752034) has the molecular formula C20H23ClN4O4S2 and a molecular weight of 483.02 g/mol. Its IUPAC name is 5-chloro-N-[2-[[4-[(Z)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[[4-[(Z)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11752034 |
| Molecular Formula | C20H23ClN4O4S2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 5-chloro-N-[2-[[4-[(Z)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)/N=C(/c1ccc(C(=O)NCCNC(=O)c2ccc(Cl)s2)cc1)N1CCCC1 |
| InChI | InChI=1S/C20H23ClN4O4S2/c1-31(28,29)24-18(25-12-2-3-13-25)14-4-6-15(7-5-14)19(26)22-10-11-23-20(27)16-8-9-17(21)30-16/h4-9H,2-3,10-13H2,1H3,(H,22,26)(H,23,27)/b24-18- |
| InChIKey | BRVUUSYNJZCHJG-MOHJPFBDSA-N |
| XLogP | 2.36 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|