C13H16N2S — CID 65451922
1-(1-benzothiophen-5-yl)-1,4-diazepane (PubChem CID 65451922) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-5-yl)-1,4-diazepane.
| Compound Name | 1-(1-benzothiophen-5-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 65451922 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-(1-benzothiophen-5-yl)-1,4-diazepane |
| SMILES | c1cc2cc(N3CCCNCC3)ccc2s1 |
| InChI | InChI=1S/C13H16N2S/c1-5-14-6-8-15(7-1)12-2-3-13-11(10-12)4-9-16-13/h2-4,9-10,14H,1,5-8H2 |
| InChIKey | NONFLXRITZGFSW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |