C14H19NO4 — CID 65454291
4-(4-carbamoyl-2,6-dimethylphenoxy)pentanoic acid (PubChem CID 65454291) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(4-carbamoyl-2,6-dimethylphenoxy)pentanoic acid.
| Compound Name | 4-(4-carbamoyl-2,6-dimethylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 65454291 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-(4-carbamoyl-2,6-dimethylphenoxy)pentanoic acid |
| SMILES | Cc1cc(C(N)=O)cc(C)c1OC(C)CCC(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-8-6-11(14(15)18)7-9(2)13(8)19-10(3)4-5-12(16)17/h6-7,10H,4-5H2,1-3H3,(H2,15,18)(H,16,17) |
| InChIKey | SLDFROAVXZVBID-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |