C16H14F2N2O — CID 65455245
4-[4-amino-2-(difluoromethyl)phenoxy]-3,5-dimethylbenzonitrile (PubChem CID 65455245) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-[4-amino-2-(difluoromethyl)phenoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[4-amino-2-(difluoromethyl)phenoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 65455245 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[4-amino-2-(difluoromethyl)phenoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C16H14F2N2O/c1-9-5-11(8-19)6-10(2)15(9)21-14-4-3-12(20)7-13(14)16(17)18/h3-7,16H,20H2,1-2H3 |
| InChIKey | GUXIJSGCMUWKOE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|