C15H13IN2O — CID 66095649
4-(4-amino-2-iodophenoxy)-3,5-dimethylbenzonitrile (PubChem CID 66095649) has the molecular formula C15H13IN2O and a molecular weight of 364.19 g/mol. Its IUPAC name is 4-(4-amino-2-iodophenoxy)-3,5-dimethylbenzonitrile.
| Compound Name | 4-(4-amino-2-iodophenoxy)-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 66095649 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 4-(4-amino-2-iodophenoxy)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccc(N)cc1I |
| InChI | InChI=1S/C15H13IN2O/c1-9-5-11(8-17)6-10(2)15(9)19-14-4-3-12(18)7-13(14)16/h3-7H,18H2,1-2H3 |
| InChIKey | ODLVHNQOADVYNC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|