About 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one
3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one (PubChem CID 654596) has the molecular formula C15H9N3O2
and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one |
| PubChem CID | 654596 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cn2cccnc2n1 |
| InChI | InChI=1S/C15H9N3O2/c19-14-11(8-10-4-1-2-5-13(10)20-14)12-9-18-7-3-6-16-15(18)17-12/h1-9H |
| InChIKey | REOYRGRFFIRARM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one?
The IUPAC name of 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one (CID 654596) is 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one.
What is the SMILES notation for 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one?
The canonical SMILES for 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one is O=c1oc2ccccc2cc1-c1cn2cccnc2n1.
What is the InChIKey of 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one?
The InChIKey is REOYRGRFFIRARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O2/c19-14-11(8-10-4-1-2-5-13(10)20-14)12-9-18-7-3-6-16-15(18)17-12/h1-9H.
What are the key properties of 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one?
3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one has a molecular weight of 263.26 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one is sourced from PubChem (CID 654596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).