C15H9N3O2 — CID 654596
3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one (PubChem CID 654596) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one.
| Compound Name | 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one |
|---|---|
| PubChem CID | 654596 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-imidazo[1,2-a]pyrimidin-2-ylchromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cn2cccnc2n1 |
| InChI | InChI=1S/C15H9N3O2/c19-14-11(8-10-4-1-2-5-13(10)20-14)12-9-18-7-3-6-16-15(18)17-12/h1-9H |
| InChIKey | REOYRGRFFIRARM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|