C22H18N2O5S — CID 654648
4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(3-prop-2-enoxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one (PubChem CID 654648) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(3-prop-2-enoxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(3-prop-2-enoxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 654648 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(3-prop-2-enoxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)c3ccc(C)o3)=C(O)C(=O)N2c2nccs2)c1 |
| InChI | InChI=1S/C22H18N2O5S/c1-3-10-28-15-6-4-5-14(12-15)18-17(19(25)16-8-7-13(2)29-16)20(26)21(27)24(18)22-23-9-11-30-22/h3-9,11-12,18,26H,1,10H2,2H3 |
| InChIKey | PYQWDQPEVCAOFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|