C11H13BrF2N2O3S — CID 65469928
2-amino-N-(4-bromo-2,6-difluorophenyl)-4-methylsulfonylbutanamide (PubChem CID 65469928) has the molecular formula C11H13BrF2N2O3S and a molecular weight of 371.20 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-2,6-difluorophenyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(4-bromo-2,6-difluorophenyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 65469928 |
| Molecular Formula | C11H13BrF2N2O3S |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-amino-N-(4-bromo-2,6-difluorophenyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H13BrF2N2O3S/c1-20(18,19)3-2-9(15)11(17)16-10-7(13)4-6(12)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | AYWOBJGPUOZRLJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |