C12H13ClN4OS — CID 65474092
3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]azepan-2-one (PubChem CID 65474092) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]azepan-2-one.
| Compound Name | 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]azepan-2-one |
|---|---|
| PubChem CID | 65474092 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]azepan-2-one |
| SMILES | O=C1NCCCCC1Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C12H13ClN4OS/c13-7-4-5-8-11(17-19-16-8)10(7)15-9-3-1-2-6-14-12(9)18/h4-5,9,15H,1-3,6H2,(H,14,18) |
| InChIKey | RXLAPELOANQZTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |