About N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide (PubChem CID 65481175) has the molecular formula C12H16N4O3S
and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide |
| PubChem CID | 65481175 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide |
| SMILES | CCNc1cc(S(=O)(=O)Nc2onc(C)c2C)ccn1 |
| InChI | InChI=1S/C12H16N4O3S/c1-4-13-11-7-10(5-6-14-11)20(17,18)16-12-8(2)9(3)15-19-12/h5-7,16H,4H2,1-3H3,(H,13,14) |
| InChIKey | WGMWFECNYJHKMD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide?
The IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide (CID 65481175) is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide.
What is the SMILES notation for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide?
The canonical SMILES for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide is CCNc1cc(S(=O)(=O)Nc2onc(C)c2C)ccn1.
What is the InChIKey of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide?
The InChIKey is WGMWFECNYJHKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O3S/c1-4-13-11-7-10(5-6-14-11)20(17,18)16-12-8(2)9(3)15-19-12/h5-7,16H,4H2,1-3H3,(H,13,14).
What are the key properties of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide?
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide has a molecular weight of 296.35 g/mol, XLogP of 1.92, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(ethylamino)pyridine-4-sulfonamide is sourced from PubChem (CID 65481175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).