C13H11F3N4S — CID 65485148
4-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 65485148) has the molecular formula C13H11F3N4S and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 65485148 |
| Molecular Formula | C13H11F3N4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CCCc1n[nH]c(=S)n1-c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N4S/c1-2-3-11-18-19-12(21)20(11)9-5-4-8(7-17)10(6-9)13(14,15)16/h4-6H,2-3H2,1H3,(H,19,21) |
| InChIKey | UBJVSBFLLWMWKV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|