C14H11BrF3NO — CID 65491032
1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 65491032) has the molecular formula C14H11BrF3NO and a molecular weight of 346.15 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 65491032 |
| Molecular Formula | C14H11BrF3NO |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1-c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11BrF3NO/c1-8-3-10(7-20)9(2)19(8)13-5-11(14(16,17)18)4-12(15)6-13/h3-7H,1-2H3 |
| InChIKey | RXSDWJQDPREZPZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|