About 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane
1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane (PubChem CID 65499489) has the molecular formula C17H27BrN2
and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane |
| PubChem CID | 65499489 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane |
| SMILES | Cc1cc(Br)cc(C)c1N1CCCNC(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H27BrN2/c1-12-9-14(18)10-13(2)16(12)20-8-6-7-19-15(11-20)17(3,4)5/h9-10,15,19H,6-8,11H2,1-5H3 |
| InChIKey | VXBUMOXYLQMHON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane?
The IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane (CID 65499489) is 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane.
What is the SMILES notation for 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane?
The canonical SMILES for 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane is Cc1cc(Br)cc(C)c1N1CCCNC(C(C)(C)C)C1.
What is the InChIKey of 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane?
The InChIKey is VXBUMOXYLQMHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BrN2/c1-12-9-14(18)10-13(2)16(12)20-8-6-7-19-15(11-20)17(3,4)5/h9-10,15,19H,6-8,11H2,1-5H3.
What are the key properties of 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane?
1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane has a molecular weight of 339.32 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane is sourced from PubChem (CID 65499489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).