C17H27BrN2 — CID 65499489
1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane (PubChem CID 65499489) has the molecular formula C17H27BrN2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane |
|---|---|
| PubChem CID | 65499489 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-tert-butyl-1,4-diazepane |
| SMILES | Cc1cc(Br)cc(C)c1N1CCCNC(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H27BrN2/c1-12-9-14(18)10-13(2)16(12)20-8-6-7-19-15(11-20)17(3,4)5/h9-10,15,19H,6-8,11H2,1-5H3 |
| InChIKey | VXBUMOXYLQMHON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |