C14H11ClF2N4O4S — CID 6553785
(1S,2R,5R)-2-[4-[4-[chloro(difluoro)methoxy]phenyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 6553785) has the molecular formula C14H11ClF2N4O4S and a molecular weight of 404.78 g/mol. Its IUPAC name is (1S,2R,5R)-2-[4-[4-[chloro(difluoro)methoxy]phenyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2R,5R)-2-[4-[4-[chloro(difluoro)methoxy]phenyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 6553785 |
| Molecular Formula | C14H11ClF2N4O4S |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (1S,2R,5R)-2-[4-[4-[chloro(difluoro)methoxy]phenyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@@H](n2nnn(-c3ccc(OC(F)(F)Cl)cc3)c2=S)[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C14H11ClF2N4O4S/c15-14(16,17)25-8-3-1-7(2-4-8)20-13(26)21(19-18-20)9-5-10(22)12-23-6-11(9)24-12/h1-4,9,11-12H,5-6H2/t9-,11-,12-/m1/s1 |
| InChIKey | KMALVPFANQZSFI-YUSALJHKSA-N |
| XLogP | 2.22 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|