C16H18N8O6S2 — CID 98063206
(1S,2S,5R)-2-[4-[2-[4-[(1R,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]ethyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 98063206) has the molecular formula C16H18N8O6S2 and a molecular weight of 482.50 g/mol. Its IUPAC name is (1S,2S,5R)-2-[4-[2-[4-[(1R,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]ethyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2S,5R)-2-[4-[2-[4-[(1R,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]ethyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 98063206 |
| Molecular Formula | C16H18N8O6S2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (1S,2S,5R)-2-[4-[2-[4-[(1R,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]ethyl]-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@@H](n2nnn(CCn3nnn([C@H]4CC(=O)[C@@H]5OC[C@H]4O5)c3=S)c2=S)[C@@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C16H18N8O6S2/c25-9-3-7(11-5-27-13(9)29-11)23-15(31)21(17-19-23)1-2-22-16(32)24(20-18-22)8-4-10(26)14-28-6-12(8)30-14/h7-8,11-14H,1-6H2/t7-,8+,11+,12-,13-,14-/m1/s1 |
| InChIKey | TVNXNJLMGVNNBY-IIHWMTQVSA-N |
| XLogP | -0.86 |
| TPSA | 142.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|