C17H14N4O3S — CID 4517588
2-(4-naphthalen-1-yl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 4517588) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(4-naphthalen-1-yl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | 2-(4-naphthalen-1-yl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 4517588 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(4-naphthalen-1-yl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1CC(n2nnn(-c3cccc4ccccc34)c2=S)C2COC1O2 |
| InChI | InChI=1S/C17H14N4O3S/c22-14-8-13(15-9-23-16(14)24-15)21-17(25)20(18-19-21)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13,15-16H,8-9H2 |
| InChIKey | NIKGNGJPFJMWDQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|