C14H14N4O4S — CID 7236034
(1S,2R,5S)-2-[4-(2-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 7236034) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is (1S,2R,5S)-2-[4-(2-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2R,5S)-2-[4-(2-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 7236034 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (1S,2R,5S)-2-[4-(2-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | COc1ccccc1-n1nnn([C@@H]2CC(=O)[C@H]3OC[C@H]2O3)c1=S |
| InChI | InChI=1S/C14H14N4O4S/c1-20-11-5-3-2-4-8(11)17-14(23)18(16-15-17)9-6-10(19)13-21-7-12(9)22-13/h2-5,9,12-13H,6-7H2,1H3/t9-,12-,13+/m1/s1 |
| InChIKey | KYIIDSFFMUGDAW-WQAKAFBOSA-N |
| XLogP | 1.06 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|