C15H14N4O5S — CID 11894084
methyl 4-[4-[(1R,2S,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]benzoate (PubChem CID 11894084) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is methyl 4-[4-[(1R,2S,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]benzoate.
| Compound Name | methyl 4-[4-[(1R,2S,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 11894084 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | methyl 4-[4-[(1R,2S,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-5-sulfanylidenetetrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2nnn([C@H]3CC(=O)[C@H]4OC[C@@H]3O4)c2=S)cc1 |
| InChI | InChI=1S/C15H14N4O5S/c1-22-13(21)8-2-4-9(5-3-8)18-15(25)19(17-16-18)10-6-11(20)14-23-7-12(10)24-14/h2-5,10,12,14H,6-7H2,1H3/t10-,12-,14-/m0/s1 |
| InChIKey | ADFLCQGWUFAUMK-JKOKRWQUSA-N |
| XLogP | 0.84 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|