C15H15ClN4O4S — CID 6556236
2-[4-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfonylguanidine (PubChem CID 6556236) has the molecular formula C15H15ClN4O4S and a molecular weight of 382.83 g/mol. Its IUPAC name is 2-[4-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 6556236 |
| Molecular Formula | C15H15ClN4O4S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[4-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(N2C(=O)[C@H]3CC=C(Cl)C[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C15H15ClN4O4S/c16-8-1-6-11-12(7-8)14(22)20(13(11)21)9-2-4-10(5-3-9)25(23,24)19-15(17)18/h1-5,11-12H,6-7H2,(H4,17,18,19)/t11-,12-/m0/s1 |
| InChIKey | GWGMPAPKEJIMBI-RYUDHWBXSA-N |
| XLogP | 0.67 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|