C24H15ClN4O5 — CID 6557168
(3aR,4R,9aR,9bR)-2-(2-chlorophenyl)-4-(3-nitrobenzoyl)-1,3-dioxo-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-8-carbonitrile (PubChem CID 6557168) has the molecular formula C24H15ClN4O5 and a molecular weight of 474.86 g/mol. Its IUPAC name is (3aR,4R,9aR,9bR)-2-(2-chlorophenyl)-4-(3-nitrobenzoyl)-1,3-dioxo-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-8-carbonitrile.
| Compound Name | (3aR,4R,9aR,9bR)-2-(2-chlorophenyl)-4-(3-nitrobenzoyl)-1,3-dioxo-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-8-carbonitrile |
|---|---|
| PubChem CID | 6557168 |
| Molecular Formula | C24H15ClN4O5 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (3aR,4R,9aR,9bR)-2-(2-chlorophenyl)-4-(3-nitrobenzoyl)-1,3-dioxo-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-8-carbonitrile |
| SMILES | N#CC1=C[C@@H]2[C@@H]3C(=O)N(c4ccccc4Cl)C(=O)[C@H]3[C@H](C(=O)c3cccc([N+](=O)[O-])c3)N2C=C1 |
| InChI | InChI=1S/C24H15ClN4O5/c25-16-6-1-2-7-17(16)28-23(31)19-18-10-13(12-26)8-9-27(18)21(20(19)24(28)32)22(30)14-4-3-5-15(11-14)29(33)34/h1-11,18-21H/t18-,19+,20-,21-/m1/s1 |
| InChIKey | YBWBKNWQBNGMGI-PLACYPQZSA-N |
| XLogP | 3.27 |
| TPSA | 124.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|