C15H22N4O2 — CID 6557830
(3R)-N-[[(2S)-oxolan-2-yl]methyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide (PubChem CID 6557830) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (3R)-N-[[(2S)-oxolan-2-yl]methyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[[(2S)-oxolan-2-yl]methyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 6557830 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3R)-N-[[(2S)-oxolan-2-yl]methyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C15H22N4O2/c20-14(18-10-13-5-2-9-21-13)12-4-1-8-19(11-12)15-16-6-3-7-17-15/h3,6-7,12-13H,1-2,4-5,8-11H2,(H,18,20)/t12-,13+/m1/s1 |
| InChIKey | RJGWWPXUFUHQRJ-OLZOCXBDSA-N |
| XLogP | 0.99 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |