C22H30N6O — CID 655893
3-[azepan-1-yl-(1-tert-butyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 655893) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[azepan-1-yl-(1-tert-butyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[azepan-1-yl-(1-tert-butyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 655893 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 3-[azepan-1-yl-(1-tert-butyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(C(c3nnnn3C(C)(C)C)N3CCCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H30N6O/c1-15-9-10-16-14-17(21(29)23-18(16)13-15)19(27-11-7-5-6-8-12-27)20-24-25-26-28(20)22(2,3)4/h9-10,13-14,19H,5-8,11-12H2,1-4H3,(H,23,29) |
| InChIKey | LILPEJIQTKKVCJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |