C18H12Cl4FN — CID 6567150
(3aS,4R,9bS)-6,8,9-trichloro-4-(2-chloro-6-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 6567150) has the molecular formula C18H12Cl4FN and a molecular weight of 403.11 g/mol. Its IUPAC name is (3aS,4R,9bS)-6,8,9-trichloro-4-(2-chloro-6-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-6,8,9-trichloro-4-(2-chloro-6-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 6567150 |
| Molecular Formula | C18H12Cl4FN |
| Molecular Weight | 403.11 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | (3aS,4R,9bS)-6,8,9-trichloro-4-(2-chloro-6-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1cccc(Cl)c1[C@@H]1Nc2c(Cl)cc(Cl)c(Cl)c2[C@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C18H12Cl4FN/c19-10-5-2-6-13(23)15(10)17-9-4-1-3-8(9)14-16(22)11(20)7-12(21)18(14)24-17/h1-3,5-9,17,24H,4H2/t8-,9-,17+/m0/s1 |
| InChIKey | VZRMBMRSPDATGR-IRWWLHRVSA-N |
| XLogP | 7.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.11 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|