About 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride
2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride (PubChem CID 657341) has the molecular formula C19H36ClNO2
and a molecular weight of 345.96 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride |
| PubChem CID | 657341 |
| Molecular Formula | C19H36ClNO2 |
| Molecular Weight | 345.96 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride |
| SMILES | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.[Cl-].[H+] |
| InChI | InChI=1S/C19H35NO2.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;/h17H,3-16H2,1-2H3;1H |
| InChIKey | GUBNMFJOJGDCEL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.96 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride?
The IUPAC name of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride (CID 657341) is 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride.
What is the SMILES notation for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride?
The canonical SMILES for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride is CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.[Cl-].[H+].
What is the InChIKey of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride?
The InChIKey is GUBNMFJOJGDCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO2.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;/h17H,3-16H2,1-2H3;1H.
What are the key properties of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride?
2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride has a molecular weight of 345.96 g/mol, XLogP of 1.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;hydron;chloride is sourced from PubChem (CID 657341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).