C9H6ClNO3S — CID 657975
methyl 6-chloro-2-sulfanylidene-1,3-benzoxazole-3-carboxylate (PubChem CID 657975) has the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. Its IUPAC name is methyl 6-chloro-2-sulfanylidene-1,3-benzoxazole-3-carboxylate.
| Compound Name | methyl 6-chloro-2-sulfanylidene-1,3-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 657975 |
| Molecular Formula | C9H6ClNO3S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | methyl 6-chloro-2-sulfanylidene-1,3-benzoxazole-3-carboxylate |
| SMILES | COC(=O)n1c(=S)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H6ClNO3S/c1-13-8(12)11-6-3-2-5(10)4-7(6)14-9(11)15/h2-4H,1H3 |
| InChIKey | IKWIGBHXGMUPCB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|