C15H10ClNO2S — CID 4670762
(6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)-(4-methylphenyl)methanone (PubChem CID 4670762) has the molecular formula C15H10ClNO2S and a molecular weight of 303.77 g/mol. Its IUPAC name is (6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)-(4-methylphenyl)methanone.
| Compound Name | (6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 4670762 |
| Molecular Formula | C15H10ClNO2S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (6-chloro-2-sulfanylidene-1,3-benzoxazol-3-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)n2c(=S)oc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C15H10ClNO2S/c1-9-2-4-10(5-3-9)14(18)17-12-7-6-11(16)8-13(12)19-15(17)20/h2-8H,1H3 |
| InChIKey | UNGHCWCDQCGLEE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|