C15H10ClNO4 — CID 90213632
(4-methylphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carboxylate (PubChem CID 90213632) has the molecular formula C15H10ClNO4 and a molecular weight of 303.70 g/mol. Its IUPAC name is (4-methylphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carboxylate.
| Compound Name | (4-methylphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 90213632 |
| Molecular Formula | C15H10ClNO4 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (4-methylphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)n2c(=O)oc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H10ClNO4/c1-9-2-5-11(6-3-9)20-14(18)17-12-8-10(16)4-7-13(12)21-15(17)19/h2-8H,1H3 |
| InChIKey | HUXXQWMKCBFXHT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |