C13H14ClNO4 — CID 10636750
ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoate (PubChem CID 10636750) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoate.
| Compound Name | ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 10636750 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC)n1c(=O)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H14ClNO4/c1-3-9(12(16)18-4-2)15-10-7-8(14)5-6-11(10)19-13(15)17/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | JFFPIPWXHIJWRI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |