C10H8ClNO4 — CID 82344620
2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (PubChem CID 82344620) has the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. Its IUPAC name is 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid.
| Compound Name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82344620 |
| Molecular Formula | C10H8ClNO4 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)n1c(=O)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H8ClNO4/c1-5(9(13)14)12-7-4-6(11)2-3-8(7)16-10(12)15/h2-5H,1H3,(H,13,14) |
| InChIKey | KZBHJBSPASVCKW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |