2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid

C10H8ClNO4 — CID 82344620

IUPAC2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid
SMILESCC(C(=O)O)n1c(=O)oc2ccc(Cl)cc21
InChIInChI=1S/C10H8ClNO4/c1-5(9(13)14)12-7-4-6(11)2-3-8(7)16-10(12)15/h2-5H,1H3,(H,13,14)
InChIKeyKZBHJBSPASVCKW-UHFFFAOYSA-N
MW241.63 g/mol
LogP1.89
Rot. Bonds2

About 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid

2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (PubChem CID 82344620) has the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. Its IUPAC name is 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid.

Molecular Properties

Compound Name2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid
PubChem CID82344620
Molecular FormulaC10H8ClNO4
Molecular Weight241.63 g/mol
Exact Mass241.01
IUPAC Name2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid
SMILESCC(C(=O)O)n1c(=O)oc2ccc(Cl)cc21
InChIInChI=1S/C10H8ClNO4/c1-5(9(13)14)12-7-4-6(11)2-3-8(7)16-10(12)15/h2-5H,1H3,(H,13,14)
InChIKeyKZBHJBSPASVCKW-UHFFFAOYSA-N
XLogP1.89
TPSA72.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.63
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid?
The IUPAC name of 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CID 82344620) is 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid.
What is the SMILES notation for 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid?
The canonical SMILES for 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid is CC(C(=O)O)n1c(=O)oc2ccc(Cl)cc21.
What is the InChIKey of 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid?
The InChIKey is KZBHJBSPASVCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO4/c1-5(9(13)14)12-7-4-6(11)2-3-8(7)16-10(12)15/h2-5H,1H3,(H,13,14).
What are the key properties of 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid?
2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid has a molecular weight of 241.63 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid is sourced from PubChem (CID 82344620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).