C28H25N5O4S — CID 6581767
(3R,7R,11Z)-11-[(4-hydroxy-3-methoxyphenyl)methylidene]-4,6-dimethyl-3,7-diphenyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione (PubChem CID 6581767) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is (3R,7R,11Z)-11-[(4-hydroxy-3-methoxyphenyl)methylidene]-4,6-dimethyl-3,7-diphenyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione.
| Compound Name | (3R,7R,11Z)-11-[(4-hydroxy-3-methoxyphenyl)methylidene]-4,6-dimethyl-3,7-diphenyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 6581767 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | (3R,7R,11Z)-11-[(4-hydroxy-3-methoxyphenyl)methylidene]-4,6-dimethyl-3,7-diphenyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
| SMILES | COc1cc(/C=c2\sc3n(c2=O)N[C@@]2(c4ccccc4)N(C)C(=O)N(C)[C@]2(c2ccccc2)N=3)ccc1O |
| InChI | InChI=1S/C28H25N5O4S/c1-31-26(36)32(2)28(20-12-8-5-9-13-20)27(31,19-10-6-4-7-11-19)29-25-33(30-28)24(35)23(38-25)17-18-14-15-21(34)22(16-18)37-3/h4-17,30,34H,1-3H3/b23-17-/t27-,28-/m0/s1 |
| InChIKey | QEUQPXVRXITPMN-WPTCVENBSA-N |
| XLogP | 2.33 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |