C17H22N4O3S — CID 177384614
(7E)-7-[(3,4-dimethoxyphenyl)methylidene]-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one (PubChem CID 177384614) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is (7E)-7-[(3,4-dimethoxyphenyl)methylidene]-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one.
| Compound Name | (7E)-7-[(3,4-dimethoxyphenyl)methylidene]-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one |
|---|---|
| PubChem CID | 177384614 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (7E)-7-[(3,4-dimethoxyphenyl)methylidene]-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one |
| SMILES | CCC1(CC)NN=c2s/c(=C/c3ccc(OC)c(OC)c3)c(=O)n2N1 |
| InChI | InChI=1S/C17H22N4O3S/c1-5-17(6-2)19-18-16-21(20-17)15(22)14(25-16)10-11-7-8-12(23-3)13(9-11)24-4/h7-10,19-20H,5-6H2,1-4H3/b14-10+ |
| InChIKey | HTSMKYHLNBDENM-GXDHUFHOSA-N |
| XLogP | 0.95 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |