C13H11ClN4O2S — CID 658851
2-chloro-N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 658851) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 2-chloro-N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 658851 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-chloro-N-cyano-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(N(C#N)S(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H11ClN4O2S/c1-9-7-10(2)17-13(16-9)18(8-15)21(19,20)12-6-4-3-5-11(12)14/h3-7H,1-2H3 |
| InChIKey | WNTKCZUPJDJMSX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|