C15H13ClN4O2S — CID 2819205
(E)-2-(2-chlorophenyl)sulfonyl-3-[(2,6-dimethylpyrimidin-4-yl)amino]prop-2-enenitrile (PubChem CID 2819205) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is (E)-2-(2-chlorophenyl)sulfonyl-3-[(2,6-dimethylpyrimidin-4-yl)amino]prop-2-enenitrile.
| Compound Name | (E)-2-(2-chlorophenyl)sulfonyl-3-[(2,6-dimethylpyrimidin-4-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 2819205 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (E)-2-(2-chlorophenyl)sulfonyl-3-[(2,6-dimethylpyrimidin-4-yl)amino]prop-2-enenitrile |
| SMILES | Cc1cc(N/C=C(\C#N)S(=O)(=O)c2ccccc2Cl)nc(C)n1 |
| InChI | InChI=1S/C15H13ClN4O2S/c1-10-7-15(20-11(2)19-10)18-9-12(8-17)23(21,22)14-6-4-3-5-13(14)16/h3-7,9H,1-2H3,(H,18,19,20)/b12-9+ |
| InChIKey | PGYLOXNUROQJQG-FMIVXFBMSA-N |
| XLogP | 3.00 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|