C10H9F6N3O — CID 659676
N-pyrimidin-2-yl-2,2-bis(trifluoromethyl)butanamide (PubChem CID 659676) has the molecular formula C10H9F6N3O and a molecular weight of 301.19 g/mol. Its IUPAC name is N-pyrimidin-2-yl-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-pyrimidin-2-yl-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 659676 |
| Molecular Formula | C10H9F6N3O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-pyrimidin-2-yl-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCC(C(=O)Nc1ncccn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F6N3O/c1-2-8(9(11,12)13,10(14,15)16)6(20)19-7-17-4-3-5-18-7/h3-5H,2H2,1H3,(H,17,18,19,20) |
| InChIKey | LLXYKXULVJYLME-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |