C7H7F3N4O3 — CID 87240308
carbamic acid;2,2,2-trifluoro-N-pyrimidin-2-ylacetamide (PubChem CID 87240308) has the molecular formula C7H7F3N4O3 and a molecular weight of 252.15 g/mol. Its IUPAC name is carbamic acid;2,2,2-trifluoro-N-pyrimidin-2-ylacetamide.
| Compound Name | carbamic acid;2,2,2-trifluoro-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 87240308 |
| Molecular Formula | C7H7F3N4O3 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | carbamic acid;2,2,2-trifluoro-N-pyrimidin-2-ylacetamide |
| SMILES | NC(=O)O.O=C(Nc1ncccn1)C(F)(F)F |
| InChI | InChI=1S/C6H4F3N3O.CH3NO2/c7-6(8,9)4(13)12-5-10-2-1-3-11-5;2-1(3)4/h1-3H,(H,10,11,12,13);2H2,(H,3,4) |
| InChIKey | ACDORSAIXNAGHW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |