C11H14F6N4O — CID 659695
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 659695) has the molecular formula C11H14F6N4O and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 659695 |
| Molecular Formula | C11H14F6N4O |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | CC(NC(=O)NCCCn1ccnc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6N4O/c1-9(10(12,13)14,11(15,16)17)20-8(22)19-3-2-5-21-6-4-18-7-21/h4,6-7H,2-3,5H2,1H3,(H2,19,20,22) |
| InChIKey | KJZQOMKBNDEAEV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|