C9H11N3O — CID 659732
2-amino-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 659732) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-amino-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 659732 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-amino-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N)c1C#N |
| InChI | InChI=1S/C9H11N3O/c1-6-3-7(5-13-2)8(4-10)9(11)12-6/h3H,5H2,1-2H3,(H2,11,12) |
| InChIKey | KOJSACKGKSAPQD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |