C15H16N4O — CID 66000514
3-(5-amino-1,3-dihydroisoindol-2-yl)-1-cyclopropylpyrazin-2-one (PubChem CID 66000514) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-cyclopropylpyrazin-2-one.
| Compound Name | 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-cyclopropylpyrazin-2-one |
|---|---|
| PubChem CID | 66000514 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-cyclopropylpyrazin-2-one |
| SMILES | Nc1ccc2c(c1)CN(c1nccn(C3CC3)c1=O)C2 |
| InChI | InChI=1S/C15H16N4O/c16-12-2-1-10-8-18(9-11(10)7-12)14-15(20)19(6-5-17-14)13-3-4-13/h1-2,5-7,13H,3-4,8-9,16H2 |
| InChIKey | UPEATARPBDUMOB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|