C14H19NO6 — CID 66001318
4-[(3,5-dimethoxybenzoyl)amino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 66001318) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[(3,5-dimethoxybenzoyl)amino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[(3,5-dimethoxybenzoyl)amino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66001318 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[(3,5-dimethoxybenzoyl)amino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | COc1cc(OC)cc(C(=O)NCC(C)(O)CC(=O)O)c1 |
| InChI | InChI=1S/C14H19NO6/c1-14(19,7-12(16)17)8-15-13(18)9-4-10(20-2)6-11(5-9)21-3/h4-6,19H,7-8H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | HMJDROXMHZFHPN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |