C10H16N8O2 — CID 66027025
3-methyl-4-nitro-1-propyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrazol-5-amine (PubChem CID 66027025) has the molecular formula C10H16N8O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-methyl-4-nitro-1-propyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrazol-5-amine.
| Compound Name | 3-methyl-4-nitro-1-propyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 66027025 |
| Molecular Formula | C10H16N8O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-methyl-4-nitro-1-propyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C10H16N8O2/c1-4-5-17-10(8(18(19)20)6(2)14-17)11-7(3)9-12-15-16-13-9/h7,11H,4-5H2,1-3H3,(H,12,13,15,16) |
| InChIKey | UTSZHMDVBSPKON-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|