C10H18N2O3 — CID 66039566
2-(1-ethylpyrazol-4-yl)-1,1-dimethoxypropan-2-ol (PubChem CID 66039566) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-1,1-dimethoxypropan-2-ol.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-1,1-dimethoxypropan-2-ol |
|---|---|
| PubChem CID | 66039566 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-1,1-dimethoxypropan-2-ol |
| SMILES | CCn1cc(C(C)(O)C(OC)OC)cn1 |
| InChI | InChI=1S/C10H18N2O3/c1-5-12-7-8(6-11-12)10(2,13)9(14-3)15-4/h6-7,9,13H,5H2,1-4H3 |
| InChIKey | IPZOQYWDPYLDOH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|