C13H18BrFO — CID 66050284
4-[2-(bromomethyl)pentyl]-2-fluoro-1-methoxybenzene (PubChem CID 66050284) has the molecular formula C13H18BrFO and a molecular weight of 289.19 g/mol. Its IUPAC name is 4-[2-(bromomethyl)pentyl]-2-fluoro-1-methoxybenzene.
| Compound Name | 4-[2-(bromomethyl)pentyl]-2-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 66050284 |
| Molecular Formula | C13H18BrFO |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-[2-(bromomethyl)pentyl]-2-fluoro-1-methoxybenzene |
| SMILES | CCCC(CBr)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H18BrFO/c1-3-4-11(9-14)7-10-5-6-13(16-2)12(15)8-10/h5-6,8,11H,3-4,7,9H2,1-2H3 |
| InChIKey | XDLNWMVKZFJYOM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|