C25H34N2O5 — CID 6605390
2-[(6R,11S)-11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide (PubChem CID 6605390) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[(6R,11S)-11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide.
| Compound Name | 2-[(6R,11S)-11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 6605390 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-[(6R,11S)-11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
| SMILES | O=C(C[C@H]1CC=CC[C@@H](Cc2ccccc2)C(=O)OCCNC1=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C25H34N2O5/c28-18-25(12-6-7-13-25)27-22(29)17-20-10-4-5-11-21(16-19-8-2-1-3-9-19)24(31)32-15-14-26-23(20)30/h1-5,8-9,20-21,28H,6-7,10-18H2,(H,26,30)(H,27,29)/t20-,21+/m1/s1 |
| InChIKey | IQJNIFHMAKERKK-RTWAWAEBSA-N |
| XLogP | 2.28 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|