C13H14FNO2S — CID 66057331
4-(dimethoxymethyl)-2-[(3-fluorophenyl)methyl]-1,3-thiazole (PubChem CID 66057331) has the molecular formula C13H14FNO2S and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-[(3-fluorophenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-[(3-fluorophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66057331 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(dimethoxymethyl)-2-[(3-fluorophenyl)methyl]-1,3-thiazole |
| SMILES | COC(OC)c1csc(Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H14FNO2S/c1-16-13(17-2)11-8-18-12(15-11)7-9-4-3-5-10(14)6-9/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | VEZSGSFLZHJBLE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|